C16H23NO3 — CID 79904766
4-(1,9-dioxaspiro[5.5]undecan-4-yloxymethyl)aniline (PubChem CID 79904766) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-(1,9-dioxaspiro[5.5]undecan-4-yloxymethyl)aniline.
| Compound Name | 4-(1,9-dioxaspiro[5.5]undecan-4-yloxymethyl)aniline |
|---|---|
| PubChem CID | 79904766 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-(1,9-dioxaspiro[5.5]undecan-4-yloxymethyl)aniline |
| SMILES | Nc1ccc(COC2CCOC3(CCOCC3)C2)cc1 |
| InChI | InChI=1S/C16H23NO3/c17-14-3-1-13(2-4-14)12-19-15-5-8-20-16(11-15)6-9-18-10-7-16/h1-4,15H,5-12,17H2 |
| InChIKey | DNGGMTGAOUVRHM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|