C16H21FO4 — CID 107690992
[4-(1,9-dioxaspiro[5.5]undecan-4-yloxy)-3-fluorophenyl]methanol (PubChem CID 107690992) has the molecular formula C16H21FO4 and a molecular weight of 296.34 g/mol. Its IUPAC name is [4-(1,9-dioxaspiro[5.5]undecan-4-yloxy)-3-fluorophenyl]methanol.
| Compound Name | [4-(1,9-dioxaspiro[5.5]undecan-4-yloxy)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 107690992 |
| Molecular Formula | C16H21FO4 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [4-(1,9-dioxaspiro[5.5]undecan-4-yloxy)-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(OC2CCOC3(CCOCC3)C2)c(F)c1 |
| InChI | InChI=1S/C16H21FO4/c17-14-9-12(11-18)1-2-15(14)21-13-3-6-20-16(10-13)4-7-19-8-5-16/h1-2,9,13,18H,3-8,10-11H2 |
| InChIKey | PFGZZYHVDJHOLM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |