C16H20BrFO3 — CID 107699038
4-[2-(bromomethyl)-4-fluorophenoxy]-1,9-dioxaspiro[5.5]undecane (PubChem CID 107699038) has the molecular formula C16H20BrFO3 and a molecular weight of 359.24 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-4-fluorophenoxy]-1,9-dioxaspiro[5.5]undecane.
| Compound Name | 4-[2-(bromomethyl)-4-fluorophenoxy]-1,9-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 107699038 |
| Molecular Formula | C16H20BrFO3 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-[2-(bromomethyl)-4-fluorophenoxy]-1,9-dioxaspiro[5.5]undecane |
| SMILES | Fc1ccc(OC2CCOC3(CCOCC3)C2)c(CBr)c1 |
| InChI | InChI=1S/C16H20BrFO3/c17-11-12-9-13(18)1-2-15(12)21-14-3-6-20-16(10-14)4-7-19-8-5-16/h1-2,9,14H,3-8,10-11H2 |
| InChIKey | AYDDEVPSRVUQQX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|