C15H19BrO3 — CID 79905383
4-(2-bromophenoxy)-1,9-dioxaspiro[5.5]undecane (PubChem CID 79905383) has the molecular formula C15H19BrO3 and a molecular weight of 327.22 g/mol. Its IUPAC name is 4-(2-bromophenoxy)-1,9-dioxaspiro[5.5]undecane.
| Compound Name | 4-(2-bromophenoxy)-1,9-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79905383 |
| Molecular Formula | C15H19BrO3 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-(2-bromophenoxy)-1,9-dioxaspiro[5.5]undecane |
| SMILES | Brc1ccccc1OC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H19BrO3/c16-13-3-1-2-4-14(13)19-12-5-8-18-15(11-12)6-9-17-10-7-15/h1-4,12H,5-11H2 |
| InChIKey | VODDTGSOTYSCRD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |