C16H22O3 — CID 103432370
9-(2,3-dimethylphenoxy)-2,6-dioxaspiro[4.5]decane (PubChem CID 103432370) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 9-(2,3-dimethylphenoxy)-2,6-dioxaspiro[4.5]decane.
| Compound Name | 9-(2,3-dimethylphenoxy)-2,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 103432370 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 9-(2,3-dimethylphenoxy)-2,6-dioxaspiro[4.5]decane |
| SMILES | Cc1cccc(OC2CCOC3(CCOC3)C2)c1C |
| InChI | InChI=1S/C16H22O3/c1-12-4-3-5-15(13(12)2)19-14-6-8-18-16(10-14)7-9-17-11-16/h3-5,14H,6-11H2,1-2H3 |
| InChIKey | JIFKPVMEUOAQQC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |