C15H19FO3 — CID 107171386
9-(3-fluoro-4-methylphenoxy)-2,6-dioxaspiro[4.5]decane (PubChem CID 107171386) has the molecular formula C15H19FO3 and a molecular weight of 266.31 g/mol. Its IUPAC name is 9-(3-fluoro-4-methylphenoxy)-2,6-dioxaspiro[4.5]decane.
| Compound Name | 9-(3-fluoro-4-methylphenoxy)-2,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 107171386 |
| Molecular Formula | C15H19FO3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 9-(3-fluoro-4-methylphenoxy)-2,6-dioxaspiro[4.5]decane |
| SMILES | Cc1ccc(OC2CCOC3(CCOC3)C2)cc1F |
| InChI | InChI=1S/C15H19FO3/c1-11-2-3-12(8-14(11)16)19-13-4-6-18-15(9-13)5-7-17-10-15/h2-3,8,13H,4-7,9-10H2,1H3 |
| InChIKey | NNEGLRSMODVQLO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |