C15H19NO5 — CID 107077160
2-amino-5-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid (PubChem CID 107077160) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-amino-5-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid.
| Compound Name | 2-amino-5-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid |
|---|---|
| PubChem CID | 107077160 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-amino-5-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid |
| SMILES | Nc1ccc(OC2CCOC3(CCOC3)C2)cc1C(=O)O |
| InChI | InChI=1S/C15H19NO5/c16-13-2-1-10(7-12(13)14(17)18)21-11-3-5-20-15(8-11)4-6-19-9-15/h1-2,7,11H,3-6,8-9,16H2,(H,17,18) |
| InChIKey | BQTFNORBHLOFHP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|