2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate

C15H18FNO4 — CID 79909001

IUPAC2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate
SMILESNc1ccc(F)c(C(=O)OC2CCOC3(CCOC3)C2)c1
InChIInChI=1S/C15H18FNO4/c16-13-2-1-10(17)7-12(13)14(18)21-11-3-5-20-15(8-11)4-6-19-9-15/h1-2,7,11H,3-6,8-9,17H2
InChIKeyGELFWRJQLYSKHI-UHFFFAOYSA-N
MW295.31 g/mol
LogP1.90
Rot. Bonds2

About 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate

2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate (PubChem CID 79909001) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate.

Molecular Properties

Compound Name2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate
PubChem CID79909001
Molecular FormulaC15H18FNO4
Molecular Weight295.31 g/mol
Exact Mass295.12
IUPAC Name2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate
SMILESNc1ccc(F)c(C(=O)OC2CCOC3(CCOC3)C2)c1
InChIInChI=1S/C15H18FNO4/c16-13-2-1-10(17)7-12(13)14(18)21-11-3-5-20-15(8-11)4-6-19-9-15/h1-2,7,11H,3-6,8-9,17H2
InChIKeyGELFWRJQLYSKHI-UHFFFAOYSA-N
XLogP1.90
TPSA70.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.31
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate?
The IUPAC name of 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate (CID 79909001) is 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate.
What is the SMILES notation for 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate?
The canonical SMILES for 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate is Nc1ccc(F)c(C(=O)OC2CCOC3(CCOC3)C2)c1.
What is the InChIKey of 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate?
The InChIKey is GELFWRJQLYSKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FNO4/c16-13-2-1-10(17)7-12(13)14(18)21-11-3-5-20-15(8-11)4-6-19-9-15/h1-2,7,11H,3-6,8-9,17H2.
What are the key properties of 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate?
2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate has a molecular weight of 295.31 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dioxaspiro[4.5]decan-9-yl 5-amino-2-fluorobenzoate is sourced from PubChem (CID 79909001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).