C16H21NO4 — CID 79908757
2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate (PubChem CID 79908757) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate.
| Compound Name | 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate |
|---|---|
| PubChem CID | 79908757 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate |
| SMILES | Nc1ccccc1CC(=O)OC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C16H21NO4/c17-14-4-2-1-3-12(14)9-15(18)21-13-5-7-20-16(10-13)6-8-19-11-16/h1-4,13H,5-11,17H2 |
| InChIKey | GLIAUNPCOBUIHO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|