2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate

C16H21NO4 — CID 79908757

IUPAC2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate
SMILESNc1ccccc1CC(=O)OC1CCOC2(CCOC2)C1
InChIInChI=1S/C16H21NO4/c17-14-4-2-1-3-12(14)9-15(18)21-13-5-7-20-16(10-13)6-8-19-11-16/h1-4,13H,5-11,17H2
InChIKeyGLIAUNPCOBUIHO-UHFFFAOYSA-N
MW291.35 g/mol
LogP1.69
Rot. Bonds3

About 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate

2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate (PubChem CID 79908757) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate.

Molecular Properties

Compound Name2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate
PubChem CID79908757
Molecular FormulaC16H21NO4
Molecular Weight291.35 g/mol
Exact Mass291.15
IUPAC Name2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate
SMILESNc1ccccc1CC(=O)OC1CCOC2(CCOC2)C1
InChIInChI=1S/C16H21NO4/c17-14-4-2-1-3-12(14)9-15(18)21-13-5-7-20-16(10-13)6-8-19-11-16/h1-4,13H,5-11,17H2
InChIKeyGLIAUNPCOBUIHO-UHFFFAOYSA-N
XLogP1.69
TPSA70.78 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate?
The IUPAC name of 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate (CID 79908757) is 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate.
What is the SMILES notation for 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate?
The canonical SMILES for 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate is Nc1ccccc1CC(=O)OC1CCOC2(CCOC2)C1.
What is the InChIKey of 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate?
The InChIKey is GLIAUNPCOBUIHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c17-14-4-2-1-3-12(14)9-15(18)21-13-5-7-20-16(10-13)6-8-19-11-16/h1-4,13H,5-11,17H2.
What are the key properties of 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate?
2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate has a molecular weight of 291.35 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dioxaspiro[4.5]decan-9-yl 2-(2-aminophenyl)acetate is sourced from PubChem (CID 79908757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).