4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid

C15H19NO5 — CID 79900845

IUPAC4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid
SMILESNc1ccc(C(=O)O)cc1OC1CCOC2(CCOC2)C1
InChIInChI=1S/C15H19NO5/c16-12-2-1-10(14(17)18)7-13(12)21-11-3-5-20-15(8-11)4-6-19-9-15/h1-2,7,11H,3-6,8-9,16H2,(H,17,18)
InChIKeyBSQPSPTYJINEEF-UHFFFAOYSA-N
MW293.32 g/mol
LogP1.68
Rot. Bonds3

About 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid

4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid (PubChem CID 79900845) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid.

Molecular Properties

Compound Name4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid
PubChem CID79900845
Molecular FormulaC15H19NO5
Molecular Weight293.32 g/mol
Exact Mass293.13
IUPAC Name4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid
SMILESNc1ccc(C(=O)O)cc1OC1CCOC2(CCOC2)C1
InChIInChI=1S/C15H19NO5/c16-12-2-1-10(14(17)18)7-13(12)21-11-3-5-20-15(8-11)4-6-19-9-15/h1-2,7,11H,3-6,8-9,16H2,(H,17,18)
InChIKeyBSQPSPTYJINEEF-UHFFFAOYSA-N
XLogP1.68
TPSA91.01 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 51.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid?
The IUPAC name of 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid (CID 79900845) is 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid.
What is the SMILES notation for 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid?
The canonical SMILES for 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid is Nc1ccc(C(=O)O)cc1OC1CCOC2(CCOC2)C1.
What is the InChIKey of 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid?
The InChIKey is BSQPSPTYJINEEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5/c16-12-2-1-10(14(17)18)7-13(12)21-11-3-5-20-15(8-11)4-6-19-9-15/h1-2,7,11H,3-6,8-9,16H2,(H,17,18).
What are the key properties of 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid?
4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid has a molecular weight of 293.32 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(2,6-dioxaspiro[4.5]decan-9-yloxy)benzoic acid is sourced from PubChem (CID 79900845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).