C15H20FNO3 — CID 114415938
4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-5-fluoro-2-methylaniline (PubChem CID 114415938) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-5-fluoro-2-methylaniline.
| Compound Name | 4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-5-fluoro-2-methylaniline |
|---|---|
| PubChem CID | 114415938 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-(2,6-dioxaspiro[4.5]decan-9-yloxy)-5-fluoro-2-methylaniline |
| SMILES | Cc1cc(OC2CCOC3(CCOC3)C2)c(F)cc1N |
| InChI | InChI=1S/C15H20FNO3/c1-10-6-14(12(16)7-13(10)17)20-11-2-4-19-15(8-11)3-5-18-9-15/h6-7,11H,2-5,8-9,17H2,1H3 |
| InChIKey | HGASRNWFLSHDMC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|