C15H18FNO3S — CID 79901370
2-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-fluorobenzenecarbothioamide (PubChem CID 79901370) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 79901370 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1OC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H18FNO3S/c16-11-2-1-3-12(13(11)14(17)21)20-10-4-6-19-15(8-10)5-7-18-9-15/h1-3,10H,4-9H2,(H2,17,21) |
| InChIKey | MWTDDBOVFBHGGX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|