C14H20N2O3 — CID 79905053
3-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-methylpyridin-2-amine (PubChem CID 79905053) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-methylpyridin-2-amine.
| Compound Name | 3-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79905053 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-(2,6-dioxaspiro[4.5]decan-9-yloxy)-6-methylpyridin-2-amine |
| SMILES | Cc1ccc(OC2CCOC3(CCOC3)C2)c(N)n1 |
| InChI | InChI=1S/C14H20N2O3/c1-10-2-3-12(13(15)16-10)19-11-4-6-18-14(8-11)5-7-17-9-14/h2-3,11H,4-9H2,1H3,(H2,15,16) |
| InChIKey | WXAGQZGQAQXVGJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |