C16H20O4S — CID 79898978
4-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid (PubChem CID 79898978) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid.
| Compound Name | 4-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid |
|---|---|
| PubChem CID | 79898978 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1OC1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C16H20O4S/c1-11-2-3-12(15(17)18)8-14(11)20-13-4-6-19-16(9-13)5-7-21-10-16/h2-3,8,13H,4-7,9-10H2,1H3,(H,17,18) |
| InChIKey | ARXPVSZZWAIPRP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |