C15H18O4S — CID 79904501
2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid (PubChem CID 79904501) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid.
| Compound Name | 2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid |
|---|---|
| PubChem CID | 79904501 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(6-oxa-2-thiaspiro[4.5]decan-9-yloxy)benzoic acid |
| SMILES | O=C(O)c1ccccc1OC1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H18O4S/c16-14(17)12-3-1-2-4-13(12)19-11-5-7-18-15(9-11)6-8-20-10-15/h1-4,11H,5-10H2,(H,16,17) |
| InChIKey | PQJYGSQWPYYCHB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |