C15H17FO4 — CID 115297905
5-fluoro-2-(5-oxaspiro[3.5]nonan-8-yloxy)benzoic acid (PubChem CID 115297905) has the molecular formula C15H17FO4 and a molecular weight of 280.30 g/mol. Its IUPAC name is 5-fluoro-2-(5-oxaspiro[3.5]nonan-8-yloxy)benzoic acid.
| Compound Name | 5-fluoro-2-(5-oxaspiro[3.5]nonan-8-yloxy)benzoic acid |
|---|---|
| PubChem CID | 115297905 |
| Molecular Formula | C15H17FO4 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-fluoro-2-(5-oxaspiro[3.5]nonan-8-yloxy)benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1OC1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H17FO4/c16-10-2-3-13(12(8-10)14(17)18)20-11-4-7-19-15(9-11)5-1-6-15/h2-3,8,11H,1,4-7,9H2,(H,17,18) |
| InChIKey | UYRJYTOLTADKTH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |