C16H18F2O2 — CID 79921615
(2,5-difluorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone (PubChem CID 79921615) has the molecular formula C16H18F2O2 and a molecular weight of 280.31 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone.
| Compound Name | (2,5-difluorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
|---|---|
| PubChem CID | 79921615 |
| Molecular Formula | C16H18F2O2 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2,5-difluorophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
| SMILES | O=C(c1cc(F)ccc1F)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C16H18F2O2/c17-12-3-4-14(18)13(9-12)15(19)11-5-8-20-16(10-11)6-1-2-7-16/h3-4,9,11H,1-2,5-8,10H2 |
| InChIKey | KACIITUJLCWYPA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |