C17H21FO2 — CID 115787768
(2-fluoro-4-methylphenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone (PubChem CID 115787768) has the molecular formula C17H21FO2 and a molecular weight of 276.35 g/mol. Its IUPAC name is (2-fluoro-4-methylphenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone.
| Compound Name | (2-fluoro-4-methylphenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
|---|---|
| PubChem CID | 115787768 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (2-fluoro-4-methylphenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCOC3(CCCC3)C2)c(F)c1 |
| InChI | InChI=1S/C17H21FO2/c1-12-4-5-14(15(18)10-12)16(19)13-6-9-20-17(11-13)7-2-3-8-17/h4-5,10,13H,2-3,6-9,11H2,1H3 |
| InChIKey | IJEOQMMAWDFUHC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |