C16H19F2NO3 — CID 99972757
N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-2,5-difluorobenzamide (PubChem CID 99972757) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-2,5-difluorobenzamide.
| Compound Name | N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 99972757 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]-2,5-difluorobenzamide |
| SMILES | O=C(N[C@@H]1CCOC2(CCOCC2)C1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H19F2NO3/c17-11-1-2-14(18)13(9-11)15(20)19-12-3-6-22-16(10-12)4-7-21-8-5-16/h1-2,9,12H,3-8,10H2,(H,19,20)/t12-/m1/s1 |
| InChIKey | OCUFYFQOKCUARC-GFCCVEGCSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |