C16H21ClN2O3 — CID 96579890
1-(3-chlorophenyl)-3-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]urea (PubChem CID 96579890) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]urea |
|---|---|
| PubChem CID | 96579890 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(4R)-1,9-dioxaspiro[5.5]undecan-4-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)N[C@@H]1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H21ClN2O3/c17-12-2-1-3-13(10-12)18-15(20)19-14-4-7-22-16(11-14)5-8-21-9-6-16/h1-3,10,14H,4-9,11H2,(H2,18,19,20)/t14-/m1/s1 |
| InChIKey | YBXRQBWCSZXSPY-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |