C18H25FN2O3 — CID 97077585
1-[3-(2-fluoroethoxy)phenyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea (PubChem CID 97077585) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-[3-(2-fluoroethoxy)phenyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea.
| Compound Name | 1-[3-(2-fluoroethoxy)phenyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
|---|---|
| PubChem CID | 97077585 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[3-(2-fluoroethoxy)phenyl]-3-[(9S)-6-oxaspiro[4.5]decan-9-yl]urea |
| SMILES | O=C(Nc1cccc(OCCF)c1)N[C@H]1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C18H25FN2O3/c19-9-11-23-16-5-3-4-14(12-16)20-17(22)21-15-6-10-24-18(13-15)7-1-2-8-18/h3-5,12,15H,1-2,6-11,13H2,(H2,20,21,22)/t15-/m0/s1 |
| InChIKey | BZHQEXKLWBURMJ-HNNXBMFYSA-N |
| XLogP | 3.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |