C20H30N2O3 — CID 98559377
1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-(4-phenoxybutyl)urea (PubChem CID 98559377) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-(4-phenoxybutyl)urea.
| Compound Name | 1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-(4-phenoxybutyl)urea |
|---|---|
| PubChem CID | 98559377 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[(9S)-6-oxaspiro[4.5]decan-9-yl]-3-(4-phenoxybutyl)urea |
| SMILES | O=C(NCCCCOc1ccccc1)N[C@H]1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C20H30N2O3/c23-19(21-13-6-7-14-24-18-8-2-1-3-9-18)22-17-10-15-25-20(16-17)11-4-5-12-20/h1-3,8-9,17H,4-7,10-16H2,(H2,21,22,23)/t17-/m0/s1 |
| InChIKey | AQEQMMYTZTVZDF-KRWDZBQOSA-N |
| XLogP | 3.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|