C18H25NO3 — CID 97235901
(2S)-2-hydroxy-N-[(4R)-1-oxaspiro[5.5]undecan-4-yl]-2-phenylacetamide (PubChem CID 97235901) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[(4R)-1-oxaspiro[5.5]undecan-4-yl]-2-phenylacetamide.
| Compound Name | (2S)-2-hydroxy-N-[(4R)-1-oxaspiro[5.5]undecan-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 97235901 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2S)-2-hydroxy-N-[(4R)-1-oxaspiro[5.5]undecan-4-yl]-2-phenylacetamide |
| SMILES | O=C(N[C@@H]1CCOC2(CCCCC2)C1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c20-16(14-7-3-1-4-8-14)17(21)19-15-9-12-22-18(13-15)10-5-2-6-11-18/h1,3-4,7-8,15-16,20H,2,5-6,9-13H2,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | GKYGVJLSSCMRIG-CVEARBPZSA-N |
| XLogP | 2.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |