C16H19ClO3 — CID 79912670
(3-chlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone (PubChem CID 79912670) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is (3-chlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone.
| Compound Name | (3-chlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone |
|---|---|
| PubChem CID | 79912670 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (3-chlorophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H19ClO3/c17-14-3-1-2-12(10-14)15(18)13-4-7-20-16(11-13)5-8-19-9-6-16/h1-3,10,13H,4-9,11H2 |
| InChIKey | KDXAIDFIBZQERD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |