C16H18Br2O3 — CID 107977143
(3,5-dibromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone (PubChem CID 107977143) has the molecular formula C16H18Br2O3 and a molecular weight of 418.13 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone.
| Compound Name | (3,5-dibromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone |
|---|---|
| PubChem CID | 107977143 |
| Molecular Formula | C16H18Br2O3 |
| Molecular Weight | 418.13 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | (3,5-dibromophenyl)-(1,9-dioxaspiro[5.5]undecan-4-yl)methanone |
| SMILES | O=C(c1cc(Br)cc(Br)c1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H18Br2O3/c17-13-7-12(8-14(18)9-13)15(19)11-1-4-21-16(10-11)2-5-20-6-3-16/h7-9,11H,1-6,10H2 |
| InChIKey | BHUSQBUXUNCRTC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.13 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |