C15H17FO2 — CID 79913116
(3-fluorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanone (PubChem CID 79913116) has the molecular formula C15H17FO2 and a molecular weight of 248.30 g/mol. Its IUPAC name is (3-fluorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanone.
| Compound Name | (3-fluorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanone |
|---|---|
| PubChem CID | 79913116 |
| Molecular Formula | C15H17FO2 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (3-fluorophenyl)-(5-oxaspiro[3.5]nonan-8-yl)methanone |
| SMILES | O=C(c1cccc(F)c1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H17FO2/c16-13-4-1-3-11(9-13)14(17)12-5-8-18-15(10-12)6-2-7-15/h1,3-4,9,12H,2,5-8,10H2 |
| InChIKey | KCJFBJJVUNDNAG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |