C17H21FO2S — CID 79909417
2-(3-fluorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone (PubChem CID 79909417) has the molecular formula C17H21FO2S and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-(3-fluorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone.
| Compound Name | 2-(3-fluorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone |
|---|---|
| PubChem CID | 79909417 |
| Molecular Formula | C17H21FO2S |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-(3-fluorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone |
| SMILES | O=C(CSc1cccc(F)c1)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H21FO2S/c18-14-4-3-5-15(10-14)21-12-16(19)13-6-9-20-17(11-13)7-1-2-8-17/h3-5,10,13H,1-2,6-9,11-12H2 |
| InChIKey | BIIZBDHCDAPNHI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |