C17H21ClO2S — CID 79909435
2-(3-chlorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone (PubChem CID 79909435) has the molecular formula C17H21ClO2S and a molecular weight of 324.87 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone |
|---|---|
| PubChem CID | 79909435 |
| Molecular Formula | C17H21ClO2S |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-1-(6-oxaspiro[4.5]decan-9-yl)ethanone |
| SMILES | O=C(CSc1cccc(Cl)c1)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H21ClO2S/c18-14-4-3-5-15(10-14)21-12-16(19)13-6-9-20-17(11-13)7-1-2-8-17/h3-5,10,13H,1-2,6-9,11-12H2 |
| InChIKey | HFJHOHGJDIVGAN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |