C18H24O2 — CID 79912329
1-(1-oxaspiro[5.5]undecan-4-yl)-2-phenylethanone (PubChem CID 79912329) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(1-oxaspiro[5.5]undecan-4-yl)-2-phenylethanone.
| Compound Name | 1-(1-oxaspiro[5.5]undecan-4-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 79912329 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-(1-oxaspiro[5.5]undecan-4-yl)-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)C1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C18H24O2/c19-17(13-15-7-3-1-4-8-15)16-9-12-20-18(14-16)10-5-2-6-11-18/h1,3-4,7-8,16H,2,5-6,9-14H2 |
| InChIKey | SVJAKYBBNDQLFB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |