C16H21NO3 — CID 116549498
2-(4-aminophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanone (PubChem CID 116549498) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanone.
| Compound Name | 2-(4-aminophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanone |
|---|---|
| PubChem CID | 116549498 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-(4-aminophenyl)-1-(2,6-dioxaspiro[4.5]decan-9-yl)ethanone |
| SMILES | Nc1ccc(CC(=O)C2CCOC3(CCOC3)C2)cc1 |
| InChI | InChI=1S/C16H21NO3/c17-14-3-1-12(2-4-14)9-15(18)13-5-7-20-16(10-13)6-8-19-11-16/h1-4,13H,5-11,17H2 |
| InChIKey | DKIDOWGBMRULTQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|