C16H21NO3 — CID 79921687
1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-pyridin-3-ylethanone (PubChem CID 79921687) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-pyridin-3-ylethanone.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 79921687 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H21NO3/c18-15(10-13-2-1-6-17-12-13)14-3-7-20-16(11-14)4-8-19-9-5-16/h1-2,6,12,14H,3-5,7-11H2 |
| InChIKey | ZOBNUMKLRAKKGA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |