C16H19BrO2S — CID 79921263
2-(3-bromophenyl)sulfanyl-1-(5-oxaspiro[3.5]nonan-8-yl)ethanone (PubChem CID 79921263) has the molecular formula C16H19BrO2S and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-1-(5-oxaspiro[3.5]nonan-8-yl)ethanone.
| Compound Name | 2-(3-bromophenyl)sulfanyl-1-(5-oxaspiro[3.5]nonan-8-yl)ethanone |
|---|---|
| PubChem CID | 79921263 |
| Molecular Formula | C16H19BrO2S |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-1-(5-oxaspiro[3.5]nonan-8-yl)ethanone |
| SMILES | O=C(CSc1cccc(Br)c1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C16H19BrO2S/c17-13-3-1-4-14(9-13)20-11-15(18)12-5-8-19-16(10-12)6-2-7-16/h1,3-4,9,12H,2,5-8,10-11H2 |
| InChIKey | YTAUTXGMNWNDHR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |