C17H23NO2 — CID 116603291
3-(3-aminophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)propan-1-one (PubChem CID 116603291) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-(3-aminophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)propan-1-one.
| Compound Name | 3-(3-aminophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)propan-1-one |
|---|---|
| PubChem CID | 116603291 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-(3-aminophenyl)-1-(5-oxaspiro[3.5]nonan-8-yl)propan-1-one |
| SMILES | Nc1cccc(CCC(=O)C2CCOC3(CCC3)C2)c1 |
| InChI | InChI=1S/C17H23NO2/c18-15-4-1-3-13(11-15)5-6-16(19)14-7-10-20-17(12-14)8-2-9-17/h1,3-4,11,14H,2,5-10,12,18H2 |
| InChIKey | PGDPBYVVANRRED-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|