C16H20BrNO2 — CID 116602799
(5-amino-2-bromophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone (PubChem CID 116602799) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is (5-amino-2-bromophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone.
| Compound Name | (5-amino-2-bromophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
|---|---|
| PubChem CID | 116602799 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (5-amino-2-bromophenyl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
| SMILES | Nc1ccc(Br)c(C(=O)C2CCOC3(CCCC3)C2)c1 |
| InChI | InChI=1S/C16H20BrNO2/c17-14-4-3-12(18)9-13(14)15(19)11-5-8-20-16(10-11)6-1-2-7-16/h3-4,9,11H,1-2,5-8,10,18H2 |
| InChIKey | WMCMTGDZHBPDSP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|