C16H21BrOS — CID 66143548
2-(3-bromophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone (PubChem CID 66143548) has the molecular formula C16H21BrOS and a molecular weight of 341.31 g/mol. Its IUPAC name is 2-(3-bromophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone.
| Compound Name | 2-(3-bromophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 66143548 |
| Molecular Formula | C16H21BrOS |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-(3-bromophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone |
| SMILES | CCC1CCCCC1C(=O)CSc1cccc(Br)c1 |
| InChI | InChI=1S/C16H21BrOS/c1-2-12-6-3-4-9-15(12)16(18)11-19-14-8-5-7-13(17)10-14/h5,7-8,10,12,15H,2-4,6,9,11H2,1H3 |
| InChIKey | NDEJOULLZXGHCO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |