C16H21ClOS — CID 66147247
2-(3-chlorophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone (PubChem CID 66147247) has the molecular formula C16H21ClOS and a molecular weight of 296.86 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 66147247 |
| Molecular Formula | C16H21ClOS |
| Molecular Weight | 296.86 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-1-(2-ethylcyclohexyl)ethanone |
| SMILES | CCC1CCCCC1C(=O)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClOS/c1-2-12-6-3-4-9-15(12)16(18)11-19-14-8-5-7-13(17)10-14/h5,7-8,10,12,15H,2-4,6,9,11H2,1H3 |
| InChIKey | KVOJBPNZXRGYSE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |