C13H17ClN2OS — CID 62647379
2-(3-chlorophenyl)sulfanyl-1-(1,4-diazepan-1-yl)ethanone (PubChem CID 62647379) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfanyl-1-(1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(3-chlorophenyl)sulfanyl-1-(1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 62647379 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(3-chlorophenyl)sulfanyl-1-(1,4-diazepan-1-yl)ethanone |
| SMILES | O=C(CSc1cccc(Cl)c1)N1CCCNCC1 |
| InChI | InChI=1S/C13H17ClN2OS/c14-11-3-1-4-12(9-11)18-10-13(17)16-7-2-5-15-6-8-16/h1,3-4,9,15H,2,5-8,10H2 |
| InChIKey | KEGNRNWYBJZCBT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |