C15H19ClN2O — CID 119415861
[2-(3-chlorophenyl)cyclopropyl]-(1,4-diazepan-1-yl)methanone (PubChem CID 119415861) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is [2-(3-chlorophenyl)cyclopropyl]-(1,4-diazepan-1-yl)methanone.
| Compound Name | [2-(3-chlorophenyl)cyclopropyl]-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 119415861 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [2-(3-chlorophenyl)cyclopropyl]-(1,4-diazepan-1-yl)methanone |
| SMILES | O=C(C1CC1c1cccc(Cl)c1)N1CCCNCC1 |
| InChI | InChI=1S/C15H19ClN2O/c16-12-4-1-3-11(9-12)13-10-14(13)15(19)18-7-2-5-17-6-8-18/h1,3-4,9,13-14,17H,2,5-8,10H2 |
| InChIKey | GWWCWKKCDMKJAE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |