C22H25ClN4O2 — CID 146147630
[(1R,2R)-2-(3-chlorophenyl)cyclopropyl]-[4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-1,4-diazepan-1-yl]methanone (PubChem CID 146147630) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is [(1R,2R)-2-(3-chlorophenyl)cyclopropyl]-[4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [(1R,2R)-2-(3-chlorophenyl)cyclopropyl]-[4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 146147630 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [(1R,2R)-2-(3-chlorophenyl)cyclopropyl]-[4-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1n[nH]c2c1CCC2)N1CCCN(C(=O)[C@@H]2C[C@H]2c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H25ClN4O2/c23-15-5-1-4-14(12-15)17-13-18(17)21(28)26-8-3-9-27(11-10-26)22(29)20-16-6-2-7-19(16)24-25-20/h1,4-5,12,17-18H,2-3,6-11,13H2,(H,24,25)/t17-,18+/m0/s1 |
| InChIKey | GQCNLHBAQYPBAQ-ZWKOTPCHSA-N |
| XLogP | 3.03 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |