C12H15Cl3N2O — CID 119417664
1,4-diazepan-1-yl-(2,6-dichlorophenyl)methanone;hydrochloride (PubChem CID 119417664) has the molecular formula C12H15Cl3N2O and a molecular weight of 309.62 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(2,6-dichlorophenyl)methanone;hydrochloride.
| Compound Name | 1,4-diazepan-1-yl-(2,6-dichlorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119417664 |
| Molecular Formula | C12H15Cl3N2O |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1,4-diazepan-1-yl-(2,6-dichlorophenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1c(Cl)cccc1Cl)N1CCCNCC1 |
| InChI | InChI=1S/C12H14Cl2N2O.ClH/c13-9-3-1-4-10(14)11(9)12(17)16-7-2-5-15-6-8-16;/h1,3-4,15H,2,5-8H2;1H |
| InChIKey | NQCGOOYARAUUDF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |