C12H14Cl2N2O — CID 81426391
(2,6-dichlorophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone (PubChem CID 81426391) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone.
| Compound Name | (2,6-dichlorophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 81426391 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (2,6-dichlorophenyl)-[(3S)-3-methylpiperazin-1-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2c(Cl)cccc2Cl)CCN1 |
| InChI | InChI=1S/C12H14Cl2N2O/c1-8-7-16(6-5-15-8)12(17)11-9(13)3-2-4-10(11)14/h2-4,8,15H,5-7H2,1H3/t8-/m0/s1 |
| InChIKey | NTYSDSMBOKEYNK-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |