C11H13Cl3N2O — CID 119403001
(2,6-dichlorophenyl)-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119403001) has the molecular formula C11H13Cl3N2O and a molecular weight of 295.60 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | (2,6-dichlorophenyl)-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119403001 |
| Molecular Formula | C11H13Cl3N2O |
| Molecular Weight | 295.60 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (2,6-dichlorophenyl)-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1c(Cl)cccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C11H12Cl2N2O.ClH/c12-8-2-1-3-9(13)10(8)11(16)15-6-4-14-5-7-15;/h1-3,14H,4-7H2;1H |
| InChIKey | MOBPYRYRPMWUDD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |