C12H15Cl2N2O+ — CID 6943179
(2,6-dichlorophenyl)-(4-methylpiperazin-4-ium-1-yl)methanone (PubChem CID 6943179) has the molecular formula C12H15Cl2N2O+ and a molecular weight of 274.17 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(4-methylpiperazin-4-ium-1-yl)methanone.
| Compound Name | (2,6-dichlorophenyl)-(4-methylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 6943179 |
| Molecular Formula | C12H15Cl2N2O+ |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2,6-dichlorophenyl)-(4-methylpiperazin-4-ium-1-yl)methanone |
| SMILES | C[NH+]1CCN(C(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C12H14Cl2N2O/c1-15-5-7-16(8-6-15)12(17)11-9(13)3-2-4-10(11)14/h2-4H,5-8H2,1H3/p+1 |
| InChIKey | IWYGRTHNHFUYDR-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |