C13H15Cl2NO — CID 644555
azepan-1-yl-(2,6-dichlorophenyl)methanone (PubChem CID 644555) has the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. Its IUPAC name is azepan-1-yl-(2,6-dichlorophenyl)methanone.
| Compound Name | azepan-1-yl-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 644555 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | azepan-1-yl-(2,6-dichlorophenyl)methanone |
| SMILES | O=C(c1c(Cl)cccc1Cl)N1CCCCCC1 |
| InChI | InChI=1S/C13H15Cl2NO/c14-10-6-5-7-11(15)12(10)13(17)16-8-3-1-2-4-9-16/h5-7H,1-4,8-9H2 |
| InChIKey | IRDDDZSVZDWIIT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |