C16H19ClOS — CID 79559089
1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)sulfanylpropan-2-one (PubChem CID 79559089) has the molecular formula C16H19ClOS and a molecular weight of 294.85 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)sulfanylpropan-2-one.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)sulfanylpropan-2-one |
|---|---|
| PubChem CID | 79559089 |
| Molecular Formula | C16H19ClOS |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-chlorophenyl)sulfanylpropan-2-one |
| SMILES | O=C(CSc1cccc(Cl)c1)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H19ClOS/c17-14-2-1-3-16(9-14)19-10-15(18)8-13-7-11-4-5-12(13)6-11/h1-3,9,11-13H,4-8,10H2 |
| InChIKey | IOOWKGBTQQAXRN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |