C15H18OS — CID 79550608
3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)benzaldehyde (PubChem CID 79550608) has the molecular formula C15H18OS and a molecular weight of 246.37 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)benzaldehyde.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 79550608 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylmethylsulfanyl)benzaldehyde |
| SMILES | O=Cc1cccc(SCC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H18OS/c16-9-12-2-1-3-15(8-12)17-10-14-7-11-4-5-13(14)6-11/h1-3,8-9,11,13-14H,4-7,10H2 |
| InChIKey | XEJSOXKYEAYQEF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|