C16H20ClN3OS — CID 11944489
1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(3-chlorophenyl)thiourea (PubChem CID 11944489) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 11944489 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-[[2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(3-chlorophenyl)thiourea |
| SMILES | O=C(C[C@H]1C[C@H]2CC[C@@H]1C2)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3OS/c17-13-2-1-3-14(9-13)18-16(22)20-19-15(21)8-12-7-10-4-5-11(12)6-10/h1-3,9-12H,4-8H2,(H,19,21)(H2,18,20,22)/t10-,11+,12+/m0/s1 |
| InChIKey | YDWKGUGQQSXVJM-QJPTWQEYSA-N |
| XLogP | 3.48 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|