C19H27N3OS — CID 21174233
1-[[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(2-ethyl-6-methylphenyl)thiourea (PubChem CID 21174233) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 1-[[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(2-ethyl-6-methylphenyl)thiourea.
| Compound Name | 1-[[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(2-ethyl-6-methylphenyl)thiourea |
|---|---|
| PubChem CID | 21174233 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[[2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]-3-(2-ethyl-6-methylphenyl)thiourea |
| SMILES | CCc1cccc(C)c1NC(=S)NNC(=O)C[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C19H27N3OS/c1-3-14-6-4-5-12(2)18(14)20-19(24)22-21-17(23)11-16-10-13-7-8-15(16)9-13/h4-6,13,15-16H,3,7-11H2,1-2H3,(H,21,23)(H2,20,22,24)/t13-,15-,16+/m1/s1 |
| InChIKey | ZIGMEZDZDIRWBV-BMFZPTHFSA-N |
| XLogP | 3.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|