C19H26N4O2S — CID 166287450
1-(2-ethyl-6-methylphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]thiourea (PubChem CID 166287450) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-(2-ethyl-6-methylphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]thiourea.
| Compound Name | 1-(2-ethyl-6-methylphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 166287450 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-(2-ethyl-6-methylphenyl)-3-[(1-prop-2-enoylpiperidine-3-carbonyl)amino]thiourea |
| SMILES | C=CC(=O)N1CCCC(C(=O)NNC(=S)Nc2c(C)cccc2CC)C1 |
| InChI | InChI=1S/C19H26N4O2S/c1-4-14-9-6-8-13(3)17(14)20-19(26)22-21-18(25)15-10-7-11-23(12-15)16(24)5-2/h5-6,8-9,15H,2,4,7,10-12H2,1,3H3,(H,21,25)(H2,20,22,26) |
| InChIKey | ISKLGUPVCYWOCC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|