C20H23N3O2S — CID 167971343
N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-1-prop-2-enoylpiperidine-3-carboxamide (PubChem CID 167971343) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-1-prop-2-enoylpiperidine-3-carboxamide.
| Compound Name | N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-1-prop-2-enoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 167971343 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-1-prop-2-enoylpiperidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCCC(C(=O)Nc2nc(-c3ccccc3)c(CC)s2)C1 |
| InChI | InChI=1S/C20H23N3O2S/c1-3-16-18(14-9-6-5-7-10-14)21-20(26-16)22-19(25)15-11-8-12-23(13-15)17(24)4-2/h4-7,9-10,15H,2-3,8,11-13H2,1H3,(H,21,22,25) |
| InChIKey | SCYXXGHWNMMYTG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|